What is the 2-PROPYL 3-METHYLBUTANETHIOATE?

2-PROPYL 3-METHYLBUTANETHIOATE is , while it's Molecular Formula is C8H16 O S. Used in Food Industry: 2-Propyl 3-methylbutanethioate is used as a flavoring agent in the food industry to impart a fruity, pineapple-like aroma to food products. Its unique scent adds a pleasant taste and aroma, enhancing the overall sensory experience of the food. Used in Beverage Industry: In the beverage industry, 2-Propyl 3-methylbutanethioate is used as a flavoring agent to give a pineapple-like flavor to various drinks. Its fruity aroma adds a refreshing and appealing taste, making beverages more enjoyable for consumers. Used in Cosmetics Industry: 2-Propyl 3-methylbutanethioate is used in the cosmetics industry as a fragrance ingredient. Its pineapple-like aroma adds a pleasant scent to various cosmetic products, such as perfumes, body lotions, and shower gels, enhancing the overall sensory experience for users.

What is the CAS number for 2-PROPYL 3-METHYLBUTANETHIOATE?

The CAS number of 2-PROPYL 3-METHYLBUTANETHIOATE is 34322-06-0.

What is 2-PROPYL 3-METHYLBUTANETHIOATE (34322-06-0) used for?

2-Propyl 3-methylbutanethioate is a chemical compound that serves as a flavoring agent, characterized by its fruity, pineapple-like aroma. It is an ester with a distinctive scent that closely resembles pineapple, making it a popular choice for enhancing the sensory experience in various products.InChI:InChI=1/C8H16OS/c1-6(2)5-8(9)10-7(3)4/h6-7H,5H2,1-4H3

What is the 2-PROPYL 3-METHYLBUTANETHIOATE?

2-PROPYL 3-METHYLBUTANETHIOATE is , while it's Molecular Formula is C8H16 O S. Used in Food Industry: 2-Propyl 3-methylbutanethioate is used as a flavoring agent in the food industry to impart a fruity, pineapple-like aroma to food products. Its unique scent adds a pleasant taste and aroma, enhancing the overall sensory experience of the food. Used in Beverage Industry: In the beverage industry, 2-Propyl 3-methylbutanethioate is used as a flavoring agent to give a pineapple-like flavor to various drinks. Its fruity aroma adds a refreshing and appealing taste, making beverages more enjoyable for consumers. Used in Cosmetics Industry: 2-Propyl 3-methylbutanethioate is used in the cosmetics industry as a fragrance ingredient. Its pineapple-like aroma adds a pleasant scent to various cosmetic products, such as perfumes, body lotions, and shower gels, enhancing the overall sensory experience for users.

What is the CAS number for 2-PROPYL 3-METHYLBUTANETHIOATE?

The CAS number of 2-PROPYL 3-METHYLBUTANETHIOATE is 34322-06-0.

What is 2-PROPYL 3-METHYLBUTANETHIOATE (34322-06-0) used for?

2-Propyl 3-methylbutanethioate is a chemical compound that serves as a flavoring agent, characterized by its fruity, pineapple-like aroma. It is an ester with a distinctive scent that closely resembles pineapple, making it a popular choice for enhancing the sensory experience in various products.InChI:InChI=1/C8H16OS/c1-6(2)5-8(9)10-7(3)4/h6-7H,5H2,1-4H3

Your Location:Home > Others > 2-PROPYL 3-METHYLBUTANETHIOATE

Product classification

2-PROPYL 3-METHYLBUTANETHIOATE

Name: 2-PROPYL 3-METHYLBUTANETHIOATE
CAS: 34322-06-0
Purity: 99%

Inquiry

Details

Top Quality Chinese Manufacturer supply 34322-06-0 2-PROPYL 3-METHYLBUTANETHIOATE

Molecular Formula: C8H16 O S
Molecular Weight: 160.28
Vapor Pressure: 0.398mmHg at 25°C
Boiling Point: 196.5°C at 760 mmHg
Flash Point: 63.2°C
PSA： 42.37000
Density: 0.929g/cm³
LogP: 2.70070